orciprenaline
/ˌɔːsɪˈprɛn(ə)liːn/Pharmacology
noun
A synthetic sympathomimetic amine closely related to isoprenaline that acts as a beta-adrenoreceptor stimulant and is used (usually in the form of the sulphate) as a bronchodilator to relieve obstructed airways in bronchitis, asthma, etc.; 1-(3,5-dihydroxyphenyl)-2-isopropylaminoethanol, C6H3(OH)2CH(OH)CH2NHCH(CH3)2.
Origin
1960s. From orci- + -prenaline.
- beat officer
- beat one's breast
- beat one's (or the) meat
- be at one's wits' end
- Beaton, Sir Cecil
- beat (or bang) the drum of (or for)
- be at (or have come to) an end
- beat (or kick) the shit out of
- be at (or on) the receiving end
- beat (or smash) someone to a pulp
- beat (or turn) swords into ploughshares
- beat (or whale) the tar out of
- beat oscillator
- beat poet
- beat poetry
- Beatrix
- beat someone at their own game
- beat someone back
- beat someone down
- beat someone hollow
- be at someone's service
- beat someone/thing off
- beat someone to it
- beat someone to the punch
- beat someone up